C19H38O3 — CID 11347574
(E,6S,7S)-nonadec-2-ene-1,6,7-triol (PubChem CID 11347574) has the molecular formula C19H38O3 and a molecular weight of 314.51 g/mol. Its IUPAC name is (E,6S,7S)-nonadec-2-ene-1,6,7-triol.
| Compound Name | (E,6S,7S)-nonadec-2-ene-1,6,7-triol |
|---|---|
| PubChem CID | 11347574 |
| Molecular Formula | C19H38O3 |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.28 |
| IUPAC Name | (E,6S,7S)-nonadec-2-ene-1,6,7-triol |
| SMILES | CCCCCCCCCCCC[C@H](O)[C@@H](O)CC/C=C/CO |
| InChI | InChI=1S/C19H38O3/c1-2-3-4-5-6-7-8-9-10-12-15-18(21)19(22)16-13-11-14-17-20/h11,14,18-22H,2-10,12-13,15-17H2,1H3/b14-11+/t18-,19-/m0/s1 |
| InChIKey | UWHCAOSLVSCMJB-XVGLWEHYSA-N |
| XLogP | 4.35 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|