C16H32O2 — CID 118508493
(Z)-hexadec-4-ene-7,8-diol (PubChem CID 118508493) has the molecular formula C16H32O2 and a molecular weight of 256.43 g/mol. Its IUPAC name is (Z)-hexadec-4-ene-7,8-diol.
| Compound Name | (Z)-hexadec-4-ene-7,8-diol |
|---|---|
| PubChem CID | 118508493 |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | (Z)-hexadec-4-ene-7,8-diol |
| SMILES | CCC/C=C\CC(O)C(O)CCCCCCCC |
| InChI | InChI=1S/C16H32O2/c1-3-5-7-9-10-12-14-16(18)15(17)13-11-8-6-4-2/h8,11,15-18H,3-7,9-10,12-14H2,1-2H3/b11-8- |
| InChIKey | CUMHEKNKWZYGMS-FLIBITNWSA-N |
| XLogP | 4.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|