About (Z)-octadec-10-en-8-ol
(Z)-octadec-10-en-8-ol (PubChem CID 173051806) has the molecular formula C18H36O
and a molecular weight of 268.48 g/mol. Its IUPAC name is (Z)-octadec-10-en-8-ol.
Molecular Properties
| Compound Name | (Z)-octadec-10-en-8-ol |
| PubChem CID | 173051806 |
| Molecular Formula | C18H36O |
| Molecular Weight | 268.48 g/mol |
| Exact Mass | 268.28 |
| IUPAC Name | (Z)-octadec-10-en-8-ol |
| SMILES | CCCCCCC/C=C\CC(O)CCCCCCC |
| InChI | InChI=1S/C18H36O/c1-3-5-7-9-10-11-13-15-17-18(19)16-14-12-8-6-4-2/h13,15,18-19H,3-12,14,16-17H2,1-2H3/b15-13- |
| InChIKey | JPGLDRFRTSOWIV-SQFISAMPSA-N |
| XLogP | 6.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.48 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-octadec-10-en-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-octadec-10-en-8-ol?
The IUPAC name of (Z)-octadec-10-en-8-ol (CID 173051806) is (Z)-octadec-10-en-8-ol.
What is the SMILES notation for (Z)-octadec-10-en-8-ol?
The canonical SMILES for (Z)-octadec-10-en-8-ol is CCCCCCC/C=C\CC(O)CCCCCCC.
What is the InChIKey of (Z)-octadec-10-en-8-ol?
The InChIKey is JPGLDRFRTSOWIV-SQFISAMPSA-N. The full InChI is InChI=1S/C18H36O/c1-3-5-7-9-10-11-13-15-17-18(19)16-14-12-8-6-4-2/h13,15,18-19H,3-12,14,16-17H2,1-2H3/b15-13-.
What are the key properties of (Z)-octadec-10-en-8-ol?
(Z)-octadec-10-en-8-ol has a molecular weight of 268.48 g/mol, XLogP of 6.01, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-octadec-10-en-8-ol is sourced from PubChem (CID 173051806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).