About (E)-heptadec-7-en-5-ol
(E)-heptadec-7-en-5-ol (PubChem CID 122442571) has the molecular formula C17H34O
and a molecular weight of 254.46 g/mol. Its IUPAC name is (E)-heptadec-7-en-5-ol.
Molecular Properties
| Compound Name | (E)-heptadec-7-en-5-ol |
| PubChem CID | 122442571 |
| Molecular Formula | C17H34O |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.26 |
| IUPAC Name | (E)-heptadec-7-en-5-ol |
| SMILES | CCCCCCCCC/C=C/CC(O)CCCC |
| InChI | InChI=1S/C17H34O/c1-3-5-7-8-9-10-11-12-13-14-16-17(18)15-6-4-2/h13-14,17-18H,3-12,15-16H2,1-2H3/b14-13+ |
| InChIKey | LSRWMYFXHPBFMN-BUHFOSPRSA-N |
| XLogP | 5.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-heptadec-7-en-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-heptadec-7-en-5-ol?
The IUPAC name of (E)-heptadec-7-en-5-ol (CID 122442571) is (E)-heptadec-7-en-5-ol.
What is the SMILES notation for (E)-heptadec-7-en-5-ol?
The canonical SMILES for (E)-heptadec-7-en-5-ol is CCCCCCCCC/C=C/CC(O)CCCC.
What is the InChIKey of (E)-heptadec-7-en-5-ol?
The InChIKey is LSRWMYFXHPBFMN-BUHFOSPRSA-N. The full InChI is InChI=1S/C17H34O/c1-3-5-7-8-9-10-11-12-13-14-16-17(18)15-6-4-2/h13-14,17-18H,3-12,15-16H2,1-2H3/b14-13+.
What are the key properties of (E)-heptadec-7-en-5-ol?
(E)-heptadec-7-en-5-ol has a molecular weight of 254.46 g/mol, XLogP of 5.62, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-heptadec-7-en-5-ol is sourced from PubChem (CID 122442571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).