C16H30O — CID 87164825
(7Z)-hexadeca-7,11-dien-5-ol (PubChem CID 87164825) has the molecular formula C16H30O and a molecular weight of 238.41 g/mol. Its IUPAC name is (7Z)-hexadeca-7,11-dien-5-ol.
| Compound Name | (7Z)-hexadeca-7,11-dien-5-ol |
|---|---|
| PubChem CID | 87164825 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | (7Z)-hexadeca-7,11-dien-5-ol |
| SMILES | CCCCC=CCC/C=C\CC(O)CCCC |
| InChI | InChI=1S/C16H30O/c1-3-5-7-8-9-10-11-12-13-15-16(17)14-6-4-2/h8-9,12-13,16-17H,3-7,10-11,14-15H2,1-2H3/b9-8?,13-12- |
| InChIKey | RDPCJBXDDMDCCQ-RIWRDTRSSA-N |
| XLogP | 5.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|