C21H42O — CID 14607531
(E,10S)-henicos-7-en-10-ol (PubChem CID 14607531) has the molecular formula C21H42O and a molecular weight of 310.57 g/mol. Its IUPAC name is (E,10S)-henicos-7-en-10-ol.
| Compound Name | (E,10S)-henicos-7-en-10-ol |
|---|---|
| PubChem CID | 14607531 |
| Molecular Formula | C21H42O |
| Molecular Weight | 310.57 g/mol |
| Exact Mass | 310.32 |
| IUPAC Name | (E,10S)-henicos-7-en-10-ol |
| SMILES | CCCCCC/C=C/C[C@@H](O)CCCCCCCCCCC |
| InChI | InChI=1S/C21H42O/c1-3-5-7-9-11-12-14-16-18-20-21(22)19-17-15-13-10-8-6-4-2/h15,17,21-22H,3-14,16,18-20H2,1-2H3/b17-15+/t21-/m1/s1 |
| InChIKey | MVLLDSWHNLOGFG-RLHAVTDZSA-N |
| XLogP | 7.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.57 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|