About 3-hydroxyhexadec-9-enal
3-hydroxyhexadec-9-enal (PubChem CID 175100822) has the molecular formula C16H30O2
and a molecular weight of 254.41 g/mol. Its IUPAC name is 3-hydroxyhexadec-9-enal.
Molecular Properties
| Compound Name | 3-hydroxyhexadec-9-enal |
| PubChem CID | 175100822 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | 3-hydroxyhexadec-9-enal |
| SMILES | CCCCCCC=CCCCCCC(O)CC=O |
| InChI | InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-16(18)14-15-17/h7-8,15-16,18H,2-6,9-14H2,1H3 |
| InChIKey | BIXOXDYXRONMAL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxyhexadec-9-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxyhexadec-9-enal?
The IUPAC name of 3-hydroxyhexadec-9-enal (CID 175100822) is 3-hydroxyhexadec-9-enal.
What is the SMILES notation for 3-hydroxyhexadec-9-enal?
The canonical SMILES for 3-hydroxyhexadec-9-enal is CCCCCCC=CCCCCCC(O)CC=O.
What is the InChIKey of 3-hydroxyhexadec-9-enal?
The InChIKey is BIXOXDYXRONMAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-16(18)14-15-17/h7-8,15-16,18H,2-6,9-14H2,1H3.
What are the key properties of 3-hydroxyhexadec-9-enal?
3-hydroxyhexadec-9-enal has a molecular weight of 254.41 g/mol, XLogP of 4.41, 13 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxyhexadec-9-enal is sourced from PubChem (CID 175100822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).