About 3-hydroxyheptadecanal
3-hydroxyheptadecanal (PubChem CID 15268158) has the molecular formula C17H34O2
and a molecular weight of 270.46 g/mol. Its IUPAC name is 3-hydroxyheptadecanal.
Molecular Properties
| Compound Name | 3-hydroxyheptadecanal |
| PubChem CID | 15268158 |
| Molecular Formula | C17H34O2 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.26 |
| IUPAC Name | 3-hydroxyheptadecanal |
| SMILES | CCCCCCCCCCCCCCC(O)CC=O |
| InChI | InChI=1S/C17H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(19)15-16-18/h16-17,19H,2-15H2,1H3 |
| InChIKey | NFZPDVULCYXALY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxyheptadecanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxyheptadecanal?
The IUPAC name of 3-hydroxyheptadecanal (CID 15268158) is 3-hydroxyheptadecanal.
What is the SMILES notation for 3-hydroxyheptadecanal?
The canonical SMILES for 3-hydroxyheptadecanal is CCCCCCCCCCCCCCC(O)CC=O.
What is the InChIKey of 3-hydroxyheptadecanal?
The InChIKey is NFZPDVULCYXALY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(19)15-16-18/h16-17,19H,2-15H2,1H3.
What are the key properties of 3-hydroxyheptadecanal?
3-hydroxyheptadecanal has a molecular weight of 270.46 g/mol, XLogP of 5.03, 15 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxyheptadecanal is sourced from PubChem (CID 15268158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).