About 3,8-dihydroxyoctanal
3,8-dihydroxyoctanal (PubChem CID 91337771) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is 3,8-dihydroxyoctanal.
Molecular Properties
| Compound Name | 3,8-dihydroxyoctanal |
| PubChem CID | 91337771 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 3,8-dihydroxyoctanal |
| SMILES | O=CCC(O)CCCCCO |
| InChI | InChI=1S/C8H16O3/c9-6-3-1-2-4-8(11)5-7-10/h7-9,11H,1-6H2 |
| InChIKey | QZLISUNRIJDCNX-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3,8-dihydroxyoctanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-dihydroxyoctanal?
The IUPAC name of 3,8-dihydroxyoctanal (CID 91337771) is 3,8-dihydroxyoctanal.
What is the SMILES notation for 3,8-dihydroxyoctanal?
The canonical SMILES for 3,8-dihydroxyoctanal is O=CCC(O)CCCCCO.
What is the InChIKey of 3,8-dihydroxyoctanal?
The InChIKey is QZLISUNRIJDCNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O3/c9-6-3-1-2-4-8(11)5-7-10/h7-9,11H,1-6H2.
What are the key properties of 3,8-dihydroxyoctanal?
3,8-dihydroxyoctanal has a molecular weight of 160.21 g/mol, XLogP of 0.49, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-dihydroxyoctanal is sourced from PubChem (CID 91337771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).