C13H28O3 — CID 90439734
tridecane-1,4,13-triol (PubChem CID 90439734) has the molecular formula C13H28O3 and a molecular weight of 232.36 g/mol. Its IUPAC name is tridecane-1,4,13-triol.
| Compound Name | tridecane-1,4,13-triol |
|---|---|
| PubChem CID | 90439734 |
| Molecular Formula | C13H28O3 |
| Molecular Weight | 232.36 g/mol |
| Exact Mass | 232.20 |
| IUPAC Name | tridecane-1,4,13-triol |
| SMILES | OCCCCCCCCCC(O)CCCO |
| InChI | InChI=1S/C13H28O3/c14-11-7-5-3-1-2-4-6-9-13(16)10-8-12-15/h13-16H,1-12H2 |
| InChIKey | XOQKCQFDUUARTB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|