About decane-1,8-diol
decane-1,8-diol (PubChem CID 160857478) has the molecular formula C20H44O4
and a molecular weight of 348.57 g/mol. Its IUPAC name is decane-1,8-diol.
Molecular Properties
| Compound Name | decane-1,8-diol |
| PubChem CID | 160857478 |
| Molecular Formula | C20H44O4 |
| Molecular Weight | 348.57 g/mol |
| Exact Mass | 348.32 |
| IUPAC Name | decane-1,8-diol |
| SMILES | CCC(O)CCCCCCCO.CCC(O)CCCCCCCO |
| InChI | InChI=1S/2C10H22O2/c2*1-2-10(12)8-6-4-3-5-7-9-11/h2*10-12H,2-9H2,1H3 |
| InChIKey | SKAXQBJJYNYTAP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decane-1,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decane-1,8-diol?
The IUPAC name of decane-1,8-diol (CID 160857478) is decane-1,8-diol.
What is the SMILES notation for decane-1,8-diol?
The canonical SMILES for decane-1,8-diol is CCC(O)CCCCCCCO.CCC(O)CCCCCCCO.
What is the InChIKey of decane-1,8-diol?
The InChIKey is SKAXQBJJYNYTAP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H22O2/c2*1-2-10(12)8-6-4-3-5-7-9-11/h2*10-12H,2-9H2,1H3.
What are the key properties of decane-1,8-diol?
decane-1,8-diol has a molecular weight of 348.57 g/mol, XLogP of 4.18, 16 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for decane-1,8-diol is sourced from PubChem (CID 160857478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).