About (3S)-3-hydroxyheptanal
(3S)-3-hydroxyheptanal (PubChem CID 15258469) has the molecular formula C7H14O2
and a molecular weight of 130.19 g/mol. Its IUPAC name is (3S)-3-hydroxyheptanal.
Molecular Properties
| Compound Name | (3S)-3-hydroxyheptanal |
| PubChem CID | 15258469 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | (3S)-3-hydroxyheptanal |
| SMILES | CCCC[C@H](O)CC=O |
| InChI | InChI=1S/C7H14O2/c1-2-3-4-7(9)5-6-8/h6-7,9H,2-5H2,1H3/t7-/m0/s1 |
| InChIKey | YJUKBFLEENWLOF-ZETCQYMHSA-N |
| XLogP | 1.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-hydroxyheptanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-hydroxyheptanal?
The IUPAC name of (3S)-3-hydroxyheptanal (CID 15258469) is (3S)-3-hydroxyheptanal.
What is the SMILES notation for (3S)-3-hydroxyheptanal?
The canonical SMILES for (3S)-3-hydroxyheptanal is CCCC[C@H](O)CC=O.
What is the InChIKey of (3S)-3-hydroxyheptanal?
The InChIKey is YJUKBFLEENWLOF-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H14O2/c1-2-3-4-7(9)5-6-8/h6-7,9H,2-5H2,1H3/t7-/m0/s1.
What are the key properties of (3S)-3-hydroxyheptanal?
(3S)-3-hydroxyheptanal has a molecular weight of 130.19 g/mol, XLogP of 1.13, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-hydroxyheptanal is sourced from PubChem (CID 15258469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).