About (Z)-tetracos-6-en-10-ol
(Z)-tetracos-6-en-10-ol (PubChem CID 168947717) has the molecular formula C24H48O
and a molecular weight of 352.65 g/mol. Its IUPAC name is (Z)-tetracos-6-en-10-ol.
Molecular Properties
| Compound Name | (Z)-tetracos-6-en-10-ol |
| PubChem CID | 168947717 |
| Molecular Formula | C24H48O |
| Molecular Weight | 352.65 g/mol |
| Exact Mass | 352.37 |
| IUPAC Name | (Z)-tetracos-6-en-10-ol |
| SMILES | CCCCC/C=C\CCC(O)CCCCCCCCCCCCCC |
| InChI | InChI=1S/C24H48O/c1-3-5-7-9-11-12-13-14-15-17-19-21-23-24(25)22-20-18-16-10-8-6-4-2/h16,18,24-25H,3-15,17,19-23H2,1-2H3/b18-16- |
| InChIKey | WWQDCVQORRDGFS-VLGSPTGOSA-N |
| XLogP | 8.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.65 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-tetracos-6-en-10-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-tetracos-6-en-10-ol?
The IUPAC name of (Z)-tetracos-6-en-10-ol (CID 168947717) is (Z)-tetracos-6-en-10-ol.
What is the SMILES notation for (Z)-tetracos-6-en-10-ol?
The canonical SMILES for (Z)-tetracos-6-en-10-ol is CCCCC/C=C\CCC(O)CCCCCCCCCCCCCC.
What is the InChIKey of (Z)-tetracos-6-en-10-ol?
The InChIKey is WWQDCVQORRDGFS-VLGSPTGOSA-N. The full InChI is InChI=1S/C24H48O/c1-3-5-7-9-11-12-13-14-15-17-19-21-23-24(25)22-20-18-16-10-8-6-4-2/h16,18,24-25H,3-15,17,19-23H2,1-2H3/b18-16-.
What are the key properties of (Z)-tetracos-6-en-10-ol?
(Z)-tetracos-6-en-10-ol has a molecular weight of 352.65 g/mol, XLogP of 8.36, 20 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-tetracos-6-en-10-ol is sourced from PubChem (CID 168947717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).