About octadec-9-ene-1,2-diol
octadec-9-ene-1,2-diol (PubChem CID 139720566) has the molecular formula C18H36O2
and a molecular weight of 284.48 g/mol. Its IUPAC name is octadec-9-ene-1,2-diol.
Molecular Properties
| Compound Name | octadec-9-ene-1,2-diol |
| PubChem CID | 139720566 |
| Molecular Formula | C18H36O2 |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.27 |
| IUPAC Name | octadec-9-ene-1,2-diol |
| SMILES | CCCCCCCCC=CCCCCCCC(O)CO |
| InChI | InChI=1S/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18(20)17-19/h9-10,18-20H,2-8,11-17H2,1H3 |
| InChIKey | IIXLLYQHXIHDPB-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze octadec-9-ene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadec-9-ene-1,2-diol?
The IUPAC name of octadec-9-ene-1,2-diol (CID 139720566) is octadec-9-ene-1,2-diol.
What is the SMILES notation for octadec-9-ene-1,2-diol?
The canonical SMILES for octadec-9-ene-1,2-diol is CCCCCCCCC=CCCCCCCC(O)CO.
What is the InChIKey of octadec-9-ene-1,2-diol?
The InChIKey is IIXLLYQHXIHDPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18(20)17-19/h9-10,18-20H,2-8,11-17H2,1H3.
What are the key properties of octadec-9-ene-1,2-diol?
octadec-9-ene-1,2-diol has a molecular weight of 284.48 g/mol, XLogP of 4.99, 15 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octadec-9-ene-1,2-diol is sourced from PubChem (CID 139720566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).