C19H38O2 — CID 142781627
(E)-nonadec-5-ene-1,2-diol (PubChem CID 142781627) has the molecular formula C19H38O2 and a molecular weight of 298.51 g/mol. Its IUPAC name is (E)-nonadec-5-ene-1,2-diol.
| Compound Name | (E)-nonadec-5-ene-1,2-diol |
|---|---|
| PubChem CID | 142781627 |
| Molecular Formula | C19H38O2 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.29 |
| IUPAC Name | (E)-nonadec-5-ene-1,2-diol |
| SMILES | CCCCCCCCCCCCC/C=C/CCC(O)CO |
| InChI | InChI=1S/C19H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(21)18-20/h14-15,19-21H,2-13,16-18H2,1H3/b15-14+ |
| InChIKey | QEKWULZCVYDUAQ-CCEZHUSRSA-N |
| XLogP | 5.38 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|