C12H24O2 — CID 10488272
(Z)-dodec-6-ene-1,3-diol (PubChem CID 10488272) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is (Z)-dodec-6-ene-1,3-diol.
| Compound Name | (Z)-dodec-6-ene-1,3-diol |
|---|---|
| PubChem CID | 10488272 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | (Z)-dodec-6-ene-1,3-diol |
| SMILES | CCCCC/C=C\CCC(O)CCO |
| InChI | InChI=1S/C12H24O2/c1-2-3-4-5-6-7-8-9-12(14)10-11-13/h6-7,12-14H,2-5,8-11H2,1H3/b7-6- |
| InChIKey | WRCUIQLZWXFKKQ-SREVYHEPSA-N |
| XLogP | 2.65 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|