C18H42O3Si2 — CID 175268067
dodec-5-ene-1,3-diol;trimethyl(trimethylsilyloxy)silane (PubChem CID 175268067) has the molecular formula C18H42O3Si2 and a molecular weight of 362.70 g/mol. Its IUPAC name is dodec-5-ene-1,3-diol;trimethyl(trimethylsilyloxy)silane.
| Compound Name | dodec-5-ene-1,3-diol;trimethyl(trimethylsilyloxy)silane |
|---|---|
| PubChem CID | 175268067 |
| Molecular Formula | C18H42O3Si2 |
| Molecular Weight | 362.70 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | dodec-5-ene-1,3-diol;trimethyl(trimethylsilyloxy)silane |
| SMILES | CCCCCCC=CCC(O)CCO.C[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C12H24O2.C6H18OSi2/c1-2-3-4-5-6-7-8-9-12(14)10-11-13;1-8(2,3)7-9(4,5)6/h7-8,12-14H,2-6,9-11H2,1H3;1-6H3 |
| InChIKey | DEVMDMWJHRVUBD-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.70 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|