C19H38O3 — CID 162937145
(2R,4R)-nonadec-6-ene-1,2,4-triol (PubChem CID 162937145) has the molecular formula C19H38O3 and a molecular weight of 314.51 g/mol. Its IUPAC name is (2R,4R)-nonadec-6-ene-1,2,4-triol.
| Compound Name | (2R,4R)-nonadec-6-ene-1,2,4-triol |
|---|---|
| PubChem CID | 162937145 |
| Molecular Formula | C19H38O3 |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.28 |
| IUPAC Name | (2R,4R)-nonadec-6-ene-1,2,4-triol |
| SMILES | CCCCCCCCCCCCC=CC[C@@H](O)C[C@@H](O)CO |
| InChI | InChI=1S/C19H38O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)16-19(22)17-20/h13-14,18-22H,2-12,15-17H2,1H3/t18-,19-/m1/s1 |
| InChIKey | YPZCQHSGCUITIP-RTBURBONSA-N |
| XLogP | 4.35 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|