C21H40O5 — CID 87293567
(Z,12R)-2-(2,3-dihydroxypropyl)-12-hydroxyoctadec-9-enoic acid (PubChem CID 87293567) has the molecular formula C21H40O5 and a molecular weight of 372.55 g/mol. Its IUPAC name is (Z,12R)-2-(2,3-dihydroxypropyl)-12-hydroxyoctadec-9-enoic acid.
| Compound Name | (Z,12R)-2-(2,3-dihydroxypropyl)-12-hydroxyoctadec-9-enoic acid |
|---|---|
| PubChem CID | 87293567 |
| Molecular Formula | C21H40O5 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.29 |
| IUPAC Name | (Z,12R)-2-(2,3-dihydroxypropyl)-12-hydroxyoctadec-9-enoic acid |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCC(CC(O)CO)C(=O)O |
| InChI | InChI=1S/C21H40O5/c1-2-3-4-11-14-19(23)15-12-9-7-5-6-8-10-13-18(21(25)26)16-20(24)17-22/h9,12,18-20,22-24H,2-8,10-11,13-17H2,1H3,(H,25,26)/b12-9-/t18?,19-,20?/m1/s1 |
| InChIKey | QWIWFQOAPUJADX-ZKSGUSAKSA-N |
| XLogP | 4.05 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|