C38H74O8 — CID 175891795
2-(2,3-dihydroxypropyl)hexadecanoic acid;2,3-dihydroxypropyl (Z)-hexadec-9-enoate (PubChem CID 175891795) has the molecular formula C38H74O8 and a molecular weight of 659.00 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropyl)hexadecanoic acid;2,3-dihydroxypropyl (Z)-hexadec-9-enoate.
| Compound Name | 2-(2,3-dihydroxypropyl)hexadecanoic acid;2,3-dihydroxypropyl (Z)-hexadec-9-enoate |
|---|---|
| PubChem CID | 175891795 |
| Molecular Formula | C38H74O8 |
| Molecular Weight | 659.00 g/mol |
| Exact Mass | 658.54 |
| IUPAC Name | 2-(2,3-dihydroxypropyl)hexadecanoic acid;2,3-dihydroxypropyl (Z)-hexadec-9-enoate |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)OCC(O)CO.CCCCCCCCCCCCCCC(CC(O)CO)C(=O)O |
| InChI | InChI=1S/C19H38O4.C19H36O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(19(22)23)15-18(21)16-20;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(22)23-17-18(21)16-20/h17-18,20-21H,2-16H2,1H3,(H,22,23);7-8,18,20-21H,2-6,9-17H2,1H3/b;8-7- |
| InChIKey | OIGVNRFRAXIBOQ-UULNMNGPSA-N |
| XLogP | 8.66 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.00 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|