C24H48O8 — CID 175690689
2-(2,3-dihydroxypropyl)decanoic acid;2,3-dihydroxypropyl octanoate (PubChem CID 175690689) has the molecular formula C24H48O8 and a molecular weight of 464.64 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropyl)decanoic acid;2,3-dihydroxypropyl octanoate.
| Compound Name | 2-(2,3-dihydroxypropyl)decanoic acid;2,3-dihydroxypropyl octanoate |
|---|---|
| PubChem CID | 175690689 |
| Molecular Formula | C24H48O8 |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | 2-(2,3-dihydroxypropyl)decanoic acid;2,3-dihydroxypropyl octanoate |
| SMILES | CCCCCCCC(=O)OCC(O)CO.CCCCCCCCC(CC(O)CO)C(=O)O |
| InChI | InChI=1S/C13H26O4.C11H22O4/c1-2-3-4-5-6-7-8-11(13(16)17)9-12(15)10-14;1-2-3-4-5-6-7-11(14)15-9-10(13)8-12/h11-12,14-15H,2-10H2,1H3,(H,16,17);10,12-13H,2-9H2,1H3 |
| InChIKey | SUMUAWFIHFQQPH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|