C42H84O8 — CID 160672733
20,21-dihydroxyhenicosanoic acid;2,3-dihydroxypropyl octadecanoate (PubChem CID 160672733) has the molecular formula C42H84O8 and a molecular weight of 717.13 g/mol. Its IUPAC name is 20,21-dihydroxyhenicosanoic acid;2,3-dihydroxypropyl octadecanoate.
| Compound Name | 20,21-dihydroxyhenicosanoic acid;2,3-dihydroxypropyl octadecanoate |
|---|---|
| PubChem CID | 160672733 |
| Molecular Formula | C42H84O8 |
| Molecular Weight | 717.13 g/mol |
| Exact Mass | 716.62 |
| IUPAC Name | 20,21-dihydroxyhenicosanoic acid;2,3-dihydroxypropyl octadecanoate |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO.O=C(O)CCCCCCCCCCCCCCCCCCC(O)CO |
| InChI | InChI=1S/2C21H42O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22;22-19-20(23)17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-21(24)25/h20,22-23H,2-19H2,1H3;20,22-23H,1-19H2,(H,24,25) |
| InChIKey | RNDIQJSQIUHMNN-UHFFFAOYSA-N |
| XLogP | 10.59 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.13 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|