C21H40O6 — CID 88538294
17-(2,3-dihydroxypropoxy)-11-methyl-17-oxoheptadecanoic acid (PubChem CID 88538294) has the molecular formula C21H40O6 and a molecular weight of 388.55 g/mol. Its IUPAC name is 17-(2,3-dihydroxypropoxy)-11-methyl-17-oxoheptadecanoic acid.
| Compound Name | 17-(2,3-dihydroxypropoxy)-11-methyl-17-oxoheptadecanoic acid |
|---|---|
| PubChem CID | 88538294 |
| Molecular Formula | C21H40O6 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | 17-(2,3-dihydroxypropoxy)-11-methyl-17-oxoheptadecanoic acid |
| SMILES | CC(CCCCCCCCCC(=O)O)CCCCCC(=O)OCC(O)CO |
| InChI | InChI=1S/C21H40O6/c1-18(12-8-5-3-2-4-6-10-14-20(24)25)13-9-7-11-15-21(26)27-17-19(23)16-22/h18-19,22-23H,2-17H2,1H3,(H,24,25) |
| InChIKey | VHIOOOUVZZXRLQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|