C22H44O8 — CID 157476858
2,3-dihydroxypropyl octanoate;2-(2,3-dihydroxypropyl)octanoic acid (PubChem CID 157476858) has the molecular formula C22H44O8 and a molecular weight of 436.59 g/mol. Its IUPAC name is 2,3-dihydroxypropyl octanoate;2-(2,3-dihydroxypropyl)octanoic acid.
| Compound Name | 2,3-dihydroxypropyl octanoate;2-(2,3-dihydroxypropyl)octanoic acid |
|---|---|
| PubChem CID | 157476858 |
| Molecular Formula | C22H44O8 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | 2,3-dihydroxypropyl octanoate;2-(2,3-dihydroxypropyl)octanoic acid |
| SMILES | CCCCCCC(CC(O)CO)C(=O)O.CCCCCCCC(=O)OCC(O)CO |
| InChI | InChI=1S/2C11H22O4/c1-2-3-4-5-6-9(11(14)15)7-10(13)8-12;1-2-3-4-5-6-7-11(14)15-9-10(13)8-12/h9-10,12-13H,2-8H2,1H3,(H,14,15);10,12-13H,2-9H2,1H3 |
| InChIKey | BVRRLDHUUPUOFF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|