C27H52O8 — CID 175263022
2,3-dihydroxypropyl (Z)-octadec-9-enoate;propanoic acid (PubChem CID 175263022) has the molecular formula C27H52O8 and a molecular weight of 504.71 g/mol. Its IUPAC name is 2,3-dihydroxypropyl (Z)-octadec-9-enoate;propanoic acid.
| Compound Name | 2,3-dihydroxypropyl (Z)-octadec-9-enoate;propanoic acid |
|---|---|
| PubChem CID | 175263022 |
| Molecular Formula | C27H52O8 |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.37 |
| IUPAC Name | 2,3-dihydroxypropyl (Z)-octadec-9-enoate;propanoic acid |
| SMILES | CCC(=O)O.CCC(=O)O.CCCCCCCC/C=C\CCCCCCCC(=O)OCC(O)CO |
| InChI | InChI=1S/C21H40O4.2C3H6O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22;2*1-2-3(4)5/h9-10,20,22-23H,2-8,11-19H2,1H3;2*2H2,1H3,(H,4,5)/b10-9-;; |
| InChIKey | HRRDTRHAEHMQLB-XXAVUKJNSA-N |
| XLogP | 5.88 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|