C21H43O4P — CID 174809478
2,3-dihydroxypropyl (Z)-octadec-9-enoate;phosphane (PubChem CID 174809478) has the molecular formula C21H43O4P and a molecular weight of 390.55 g/mol. Its IUPAC name is 2,3-dihydroxypropyl (Z)-octadec-9-enoate;phosphane.
| Compound Name | 2,3-dihydroxypropyl (Z)-octadec-9-enoate;phosphane |
|---|---|
| PubChem CID | 174809478 |
| Molecular Formula | C21H43O4P |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.29 |
| IUPAC Name | 2,3-dihydroxypropyl (Z)-octadec-9-enoate;phosphane |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(O)CO.P |
| InChI | InChI=1S/C21H40O4.H3P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22;/h9-10,20,22-23H,2-8,11-19H2,1H3;1H3/b10-9-; |
| InChIKey | ZVXVZNUHNUCMOM-KVVVOXFISA-N |
| XLogP | 4.98 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|