C21H38O4 — CID 23654475
2,3-dihydroxypropyl (9Z,11E)-octadeca-9,11-dienoate (PubChem CID 23654475) has the molecular formula C21H38O4 and a molecular weight of 354.53 g/mol. Its IUPAC name is 2,3-dihydroxypropyl (9Z,11E)-octadeca-9,11-dienoate.
| Compound Name | 2,3-dihydroxypropyl (9Z,11E)-octadeca-9,11-dienoate |
|---|---|
| PubChem CID | 23654475 |
| Molecular Formula | C21H38O4 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | 2,3-dihydroxypropyl (9Z,11E)-octadeca-9,11-dienoate |
| SMILES | CCCCCC/C=C/C=C\CCCCCCCC(=O)OCC(O)CO |
| InChI | InChI=1S/C21H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h7-10,20,22-23H,2-6,11-19H2,1H3/b8-7+,10-9- |
| InChIKey | PHVCHTSWKCRQCO-GOJKSUSPSA-N |
| XLogP | 4.70 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|