C21H36O5 — CID 162989792
[(2R)-2,3-dihydroxypropyl] (10E,12E)-9-oxooctadeca-10,12-dienoate (PubChem CID 162989792) has the molecular formula C21H36O5 and a molecular weight of 368.51 g/mol. Its IUPAC name is [(2R)-2,3-dihydroxypropyl] (10E,12E)-9-oxooctadeca-10,12-dienoate.
| Compound Name | [(2R)-2,3-dihydroxypropyl] (10E,12E)-9-oxooctadeca-10,12-dienoate |
|---|---|
| PubChem CID | 162989792 |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | [(2R)-2,3-dihydroxypropyl] (10E,12E)-9-oxooctadeca-10,12-dienoate |
| SMILES | CCCCC/C=C/C=C/C(=O)CCCCCCCC(=O)OC[C@H](O)CO |
| InChI | InChI=1S/C21H36O5/c1-2-3-4-5-6-8-11-14-19(23)15-12-9-7-10-13-16-21(25)26-18-20(24)17-22/h6,8,11,14,20,22,24H,2-5,7,9-10,12-13,15-18H2,1H3/b8-6+,14-11+/t20-/m1/s1 |
| InChIKey | JQIUXUDRBWTUPQ-UCNUHKKNSA-N |
| XLogP | 3.88 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|