C33H54O6 — CID 157002607
[(2S)-3-decanoyloxy-2-hydroxypropyl] (6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoate (PubChem CID 157002607) has the molecular formula C33H54O6 and a molecular weight of 546.79 g/mol. Its IUPAC name is [(2S)-3-decanoyloxy-2-hydroxypropyl] (6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoate.
| Compound Name | [(2S)-3-decanoyloxy-2-hydroxypropyl] (6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 157002607 |
| Molecular Formula | C33H54O6 |
| Molecular Weight | 546.79 g/mol |
| Exact Mass | 546.39 |
| IUPAC Name | [(2S)-3-decanoyloxy-2-hydroxypropyl] (6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C=C\C(=O)CCCC(=O)OC[C@@H](O)COC(=O)CCCCCCCCC |
| InChI | InChI=1S/C33H54O6/c1-3-5-7-9-11-12-13-14-15-16-18-19-21-24-30(34)25-23-27-33(37)39-29-31(35)28-38-32(36)26-22-20-17-10-8-6-4-2/h11-12,14-15,18-19,21,24,31,35H,3-10,13,16-17,20,22-23,25-29H2,1-2H3/b12-11-,15-14-,19-18-,24-21+/t31-/m0/s1 |
| InChIKey | VYYMKBGJOHEYSB-OSSCPHELSA-N |
| XLogP | 7.90 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.79 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|