C25H38O6 — CID 157005061
[(2S)-3-acetyloxy-2-hydroxypropyl] (5Z,8Z,11Z,13E)-15-oxoicosa-5,8,11,13-tetraenoate (PubChem CID 157005061) has the molecular formula C25H38O6 and a molecular weight of 434.57 g/mol. Its IUPAC name is [(2S)-3-acetyloxy-2-hydroxypropyl] (5Z,8Z,11Z,13E)-15-oxoicosa-5,8,11,13-tetraenoate.
| Compound Name | [(2S)-3-acetyloxy-2-hydroxypropyl] (5Z,8Z,11Z,13E)-15-oxoicosa-5,8,11,13-tetraenoate |
|---|---|
| PubChem CID | 157005061 |
| Molecular Formula | C25H38O6 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | [(2S)-3-acetyloxy-2-hydroxypropyl] (5Z,8Z,11Z,13E)-15-oxoicosa-5,8,11,13-tetraenoate |
| SMILES | CCCCCC(=O)/C=C/C=C\C/C=C\C/C=C\CCCC(=O)OC[C@@H](O)COC(C)=O |
| InChI | InChI=1S/C25H38O6/c1-3-4-14-17-23(27)18-15-12-10-8-6-5-7-9-11-13-16-19-25(29)31-21-24(28)20-30-22(2)26/h5-6,9-12,15,18,24,28H,3-4,7-8,13-14,16-17,19-21H2,1-2H3/b6-5-,11-9-,12-10-,18-15+/t24-/m0/s1 |
| InChIKey | HUFQQIAQHYRMLD-CFNVVHEOSA-N |
| XLogP | 4.78 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|