C39H72O6 — CID 87873638
2,3-dihydroxypropyl (Z)-octadec-9-enoate;(9Z,12Z)-octadeca-9,12-dienoic acid (PubChem CID 87873638) has the molecular formula C39H72O6 and a molecular weight of 637.00 g/mol. Its IUPAC name is 2,3-dihydroxypropyl (Z)-octadec-9-enoate;(9Z,12Z)-octadeca-9,12-dienoic acid.
| Compound Name | 2,3-dihydroxypropyl (Z)-octadec-9-enoate;(9Z,12Z)-octadeca-9,12-dienoic acid |
|---|---|
| PubChem CID | 87873638 |
| Molecular Formula | C39H72O6 |
| Molecular Weight | 637.00 g/mol |
| Exact Mass | 636.53 |
| IUPAC Name | 2,3-dihydroxypropyl (Z)-octadec-9-enoate;(9Z,12Z)-octadeca-9,12-dienoic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)O.CCCCCCCC/C=C\CCCCCCCC(=O)OCC(O)CO |
| InChI | InChI=1S/C21H40O4.C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10,20,22-23H,2-8,11-19H2,1H3;6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20)/b10-9-;7-6-,10-9- |
| InChIKey | JVBQIVPIOLGAKY-BFIYWSAOSA-N |
| XLogP | 10.80 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.00 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|