C19H34O4 — CID 138276528
2,3-dihydroxypropyl (9Z,12Z)-hexadeca-9,12-dienoate (PubChem CID 138276528) has the molecular formula C19H34O4 and a molecular weight of 326.48 g/mol. Its IUPAC name is 2,3-dihydroxypropyl (9Z,12Z)-hexadeca-9,12-dienoate.
| Compound Name | 2,3-dihydroxypropyl (9Z,12Z)-hexadeca-9,12-dienoate |
|---|---|
| PubChem CID | 138276528 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | 2,3-dihydroxypropyl (9Z,12Z)-hexadeca-9,12-dienoate |
| SMILES | CCC/C=C\C/C=C\CCCCCCCC(=O)OCC(O)CO |
| InChI | InChI=1S/C19H34O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(22)23-17-18(21)16-20/h4-5,7-8,18,20-21H,2-3,6,9-17H2,1H3/b5-4-,8-7- |
| InChIKey | UYILNCYYYVUPEC-UTOQUPLUSA-N |
| XLogP | 3.92 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|