C20H36O4 — CID 138225175
2,3-dihydroxypropyl (9Z,12Z)-heptadeca-9,12-dienoate (PubChem CID 138225175) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is 2,3-dihydroxypropyl (9Z,12Z)-heptadeca-9,12-dienoate.
| Compound Name | 2,3-dihydroxypropyl (9Z,12Z)-heptadeca-9,12-dienoate |
|---|---|
| PubChem CID | 138225175 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | 2,3-dihydroxypropyl (9Z,12Z)-heptadeca-9,12-dienoate |
| SMILES | CCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(O)CO |
| InChI | InChI=1S/C20H36O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20(23)24-18-19(22)17-21/h5-6,8-9,19,21-22H,2-4,7,10-18H2,1H3/b6-5-,9-8- |
| InChIKey | OBSCAFUULBCARL-AFJQJTPPSA-N |
| XLogP | 4.31 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|