C55H102O8 — CID 175768862
2,3-dihydroxypropyl hexadecanoate;bis((9Z,12Z)-octadeca-9,12-dienoic acid) (PubChem CID 175768862) has the molecular formula C55H102O8 and a molecular weight of 891.41 g/mol. Its IUPAC name is 2,3-dihydroxypropyl hexadecanoate;bis((9Z,12Z)-octadeca-9,12-dienoic acid).
| Compound Name | 2,3-dihydroxypropyl hexadecanoate;bis((9Z,12Z)-octadeca-9,12-dienoic acid) |
|---|---|
| PubChem CID | 175768862 |
| Molecular Formula | C55H102O8 |
| Molecular Weight | 891.41 g/mol |
| Exact Mass | 890.76 |
| IUPAC Name | 2,3-dihydroxypropyl hexadecanoate;bis((9Z,12Z)-octadeca-9,12-dienoic acid) |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)O.CCCCC/C=C\C/C=C\CCCCCCCC(=O)O.CCCCCCCCCCCCCCCC(=O)OCC(O)CO |
| InChI | InChI=1S/C19H38O4.2C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(22)23-17-18(21)16-20;2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h18,20-21H,2-17H2,1H3;2*6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20)/b;2*7-6-,10-9- |
| InChIKey | YHHKHULECOPTRT-BNIFLCCKSA-N |
| XLogP | 16.13 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.41 |
| LogP ≤ 5 | 16.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|