3,5-dihydroxytetradec-7-enoic acid

C14H26O4 — CID 54529529

IUPAC3,5-dihydroxytetradec-7-enoic acid
SMILESCCCCCCC=CCC(O)CC(O)CC(=O)O
InChIInChI=1S/C14H26O4/c1-2-3-4-5-6-7-8-9-12(15)10-13(16)11-14(17)18/h7-8,12-13,15-16H,2-6,9-11H2,1H3,(H,17,18)
InChIKeyYVNDMSRNNBRKCU-UHFFFAOYSA-N
MW258.36 g/mol
LogP2.49
Rot. Bonds11

About 3,5-dihydroxytetradec-7-enoic acid

3,5-dihydroxytetradec-7-enoic acid (PubChem CID 54529529) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is 3,5-dihydroxytetradec-7-enoic acid.

Molecular Properties

Compound Name3,5-dihydroxytetradec-7-enoic acid
PubChem CID54529529
Molecular FormulaC14H26O4
Molecular Weight258.36 g/mol
Exact Mass258.18
IUPAC Name3,5-dihydroxytetradec-7-enoic acid
SMILESCCCCCCC=CCC(O)CC(O)CC(=O)O
InChIInChI=1S/C14H26O4/c1-2-3-4-5-6-7-8-9-12(15)10-13(16)11-14(17)18/h7-8,12-13,15-16H,2-6,9-11H2,1H3,(H,17,18)
InChIKeyYVNDMSRNNBRKCU-UHFFFAOYSA-N
XLogP2.49
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds11
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.36
LogP ≤ 52.49
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 3,5-dihydroxytetradec-7-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-dihydroxytetradec-7-enoic acid?
The IUPAC name of 3,5-dihydroxytetradec-7-enoic acid (CID 54529529) is 3,5-dihydroxytetradec-7-enoic acid.
What is the SMILES notation for 3,5-dihydroxytetradec-7-enoic acid?
The canonical SMILES for 3,5-dihydroxytetradec-7-enoic acid is CCCCCCC=CCC(O)CC(O)CC(=O)O.
What is the InChIKey of 3,5-dihydroxytetradec-7-enoic acid?
The InChIKey is YVNDMSRNNBRKCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O4/c1-2-3-4-5-6-7-8-9-12(15)10-13(16)11-14(17)18/h7-8,12-13,15-16H,2-6,9-11H2,1H3,(H,17,18).
What are the key properties of 3,5-dihydroxytetradec-7-enoic acid?
3,5-dihydroxytetradec-7-enoic acid has a molecular weight of 258.36 g/mol, XLogP of 2.49, 11 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dihydroxytetradec-7-enoic acid is sourced from PubChem (CID 54529529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).