C14H26O3 — CID 24881363
(Z,3R)-3-hydroxytetradec-7-enoic acid (PubChem CID 24881363) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is (Z,3R)-3-hydroxytetradec-7-enoic acid.
| Compound Name | (Z,3R)-3-hydroxytetradec-7-enoic acid |
|---|---|
| PubChem CID | 24881363 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | (Z,3R)-3-hydroxytetradec-7-enoic acid |
| SMILES | CCCCCC/C=C\CCC[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C14H26O3/c1-2-3-4-5-6-7-8-9-10-11-13(15)12-14(16)17/h7-8,13,15H,2-6,9-12H2,1H3,(H,16,17)/b8-7-/t13-/m1/s1 |
| InChIKey | XEDLAVDOPNIEBY-MEJMFZKBSA-N |
| XLogP | 3.52 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|