About 3-hydroxyoctanoic acid
3-hydroxyoctanoic acid (PubChem CID 159718411) has the molecular formula C16H32O6
and a molecular weight of 320.43 g/mol. Its IUPAC name is 3-hydroxyoctanoic acid.
Molecular Properties
| Compound Name | 3-hydroxyoctanoic acid |
| PubChem CID | 159718411 |
| Molecular Formula | C16H32O6 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 3-hydroxyoctanoic acid |
| SMILES | CCCCCC(O)CC(=O)O.CCCCCC(O)CC(=O)O |
| InChI | InChI=1S/2C8H16O3/c2*1-2-3-4-5-7(9)6-8(10)11/h2*7,9H,2-6H2,1H3,(H,10,11) |
| InChIKey | MZSLLZQNZYTGFO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxyoctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxyoctanoic acid?
The IUPAC name of 3-hydroxyoctanoic acid (CID 159718411) is 3-hydroxyoctanoic acid.
What is the SMILES notation for 3-hydroxyoctanoic acid?
The canonical SMILES for 3-hydroxyoctanoic acid is CCCCCC(O)CC(=O)O.CCCCCC(O)CC(=O)O.
What is the InChIKey of 3-hydroxyoctanoic acid?
The InChIKey is MZSLLZQNZYTGFO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H16O3/c2*1-2-3-4-5-7(9)6-8(10)11/h2*7,9H,2-6H2,1H3,(H,10,11).
What are the key properties of 3-hydroxyoctanoic acid?
3-hydroxyoctanoic acid has a molecular weight of 320.43 g/mol, XLogP of 2.80, 12 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxyoctanoic acid is sourced from PubChem (CID 159718411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).