About 3-hydroxyhexanoic acid;methane
3-hydroxyhexanoic acid;methane (PubChem CID 175209406) has the molecular formula C7H16O3
and a molecular weight of 148.20 g/mol. Its IUPAC name is 3-hydroxyhexanoic acid;methane.
Molecular Properties
| Compound Name | 3-hydroxyhexanoic acid;methane |
| PubChem CID | 175209406 |
| Molecular Formula | C7H16O3 |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | 3-hydroxyhexanoic acid;methane |
| SMILES | C.CCCC(O)CC(=O)O |
| InChI | InChI=1S/C6H12O3.CH4/c1-2-3-5(7)4-6(8)9;/h5,7H,2-4H2,1H3,(H,8,9);1H4 |
| InChIKey | HIMHVXZDLFEGNW-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-hydroxyhexanoic acid;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxyhexanoic acid;methane?
The IUPAC name of 3-hydroxyhexanoic acid;methane (CID 175209406) is 3-hydroxyhexanoic acid;methane.
What is the SMILES notation for 3-hydroxyhexanoic acid;methane?
The canonical SMILES for 3-hydroxyhexanoic acid;methane is C.CCCC(O)CC(=O)O.
What is the InChIKey of 3-hydroxyhexanoic acid;methane?
The InChIKey is HIMHVXZDLFEGNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3.CH4/c1-2-3-5(7)4-6(8)9;/h5,7H,2-4H2,1H3,(H,8,9);1H4.
What are the key properties of 3-hydroxyhexanoic acid;methane?
3-hydroxyhexanoic acid;methane has a molecular weight of 148.20 g/mol, XLogP of 1.26, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxyhexanoic acid;methane is sourced from PubChem (CID 175209406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).