About 6-hydroxynonan-4-one
6-hydroxynonan-4-one (PubChem CID 22287595) has the molecular formula C9H18O2
and a molecular weight of 158.24 g/mol. Its IUPAC name is 6-hydroxynonan-4-one.
Molecular Properties
| Compound Name | 6-hydroxynonan-4-one |
| PubChem CID | 22287595 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | 6-hydroxynonan-4-one |
| SMILES | CCCC(=O)CC(O)CCC |
| InChI | InChI=1S/C9H18O2/c1-3-5-8(10)7-9(11)6-4-2/h8,10H,3-7H2,1-2H3 |
| InChIKey | MRCPQWJUIUDGMZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-hydroxynonan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxynonan-4-one?
The IUPAC name of 6-hydroxynonan-4-one (CID 22287595) is 6-hydroxynonan-4-one.
What is the SMILES notation for 6-hydroxynonan-4-one?
The canonical SMILES for 6-hydroxynonan-4-one is CCCC(=O)CC(O)CCC.
What is the InChIKey of 6-hydroxynonan-4-one?
The InChIKey is MRCPQWJUIUDGMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2/c1-3-5-8(10)7-9(11)6-4-2/h8,10H,3-7H2,1-2H3.
What are the key properties of 6-hydroxynonan-4-one?
6-hydroxynonan-4-one has a molecular weight of 158.24 g/mol, XLogP of 1.91, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxynonan-4-one is sourced from PubChem (CID 22287595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).