About 6-hydroxy-4-oxodecanoic acid
6-hydroxy-4-oxodecanoic acid (PubChem CID 14616482) has the molecular formula C10H18O4
and a molecular weight of 202.25 g/mol. Its IUPAC name is 6-hydroxy-4-oxodecanoic acid.
Molecular Properties
| Compound Name | 6-hydroxy-4-oxodecanoic acid |
| PubChem CID | 14616482 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 6-hydroxy-4-oxodecanoic acid |
| SMILES | CCCCC(O)CC(=O)CCC(=O)O |
| InChI | InChI=1S/C10H18O4/c1-2-3-4-8(11)7-9(12)5-6-10(13)14/h8,11H,2-7H2,1H3,(H,13,14) |
| InChIKey | BUQOOORJWDHBAC-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-hydroxy-4-oxodecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-4-oxodecanoic acid?
The IUPAC name of 6-hydroxy-4-oxodecanoic acid (CID 14616482) is 6-hydroxy-4-oxodecanoic acid.
What is the SMILES notation for 6-hydroxy-4-oxodecanoic acid?
The canonical SMILES for 6-hydroxy-4-oxodecanoic acid is CCCCC(O)CC(=O)CCC(=O)O.
What is the InChIKey of 6-hydroxy-4-oxodecanoic acid?
The InChIKey is BUQOOORJWDHBAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4/c1-2-3-4-8(11)7-9(12)5-6-10(13)14/h8,11H,2-7H2,1H3,(H,13,14).
What are the key properties of 6-hydroxy-4-oxodecanoic acid?
6-hydroxy-4-oxodecanoic acid has a molecular weight of 202.25 g/mol, XLogP of 1.36, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-4-oxodecanoic acid is sourced from PubChem (CID 14616482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).