6-hydroxy-4-oxodecanoic acid

C10H18O4 — CID 14616482

IUPAC6-hydroxy-4-oxodecanoic acid
SMILESCCCCC(O)CC(=O)CCC(=O)O
InChIInChI=1S/C10H18O4/c1-2-3-4-8(11)7-9(12)5-6-10(13)14/h8,11H,2-7H2,1H3,(H,13,14)
InChIKeyBUQOOORJWDHBAC-UHFFFAOYSA-N
MW202.25 g/mol
LogP1.36
Rot. Bonds8

About 6-hydroxy-4-oxodecanoic acid

6-hydroxy-4-oxodecanoic acid (PubChem CID 14616482) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is 6-hydroxy-4-oxodecanoic acid.

Molecular Properties

Compound Name6-hydroxy-4-oxodecanoic acid
PubChem CID14616482
Molecular FormulaC10H18O4
Molecular Weight202.25 g/mol
Exact Mass202.12
IUPAC Name6-hydroxy-4-oxodecanoic acid
SMILESCCCCC(O)CC(=O)CCC(=O)O
InChIInChI=1S/C10H18O4/c1-2-3-4-8(11)7-9(12)5-6-10(13)14/h8,11H,2-7H2,1H3,(H,13,14)
InChIKeyBUQOOORJWDHBAC-UHFFFAOYSA-N
XLogP1.36
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.25
LogP ≤ 51.36
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 6-hydroxy-4-oxodecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-hydroxy-4-oxodecanoic acid?
The IUPAC name of 6-hydroxy-4-oxodecanoic acid (CID 14616482) is 6-hydroxy-4-oxodecanoic acid.
What is the SMILES notation for 6-hydroxy-4-oxodecanoic acid?
The canonical SMILES for 6-hydroxy-4-oxodecanoic acid is CCCCC(O)CC(=O)CCC(=O)O.
What is the InChIKey of 6-hydroxy-4-oxodecanoic acid?
The InChIKey is BUQOOORJWDHBAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4/c1-2-3-4-8(11)7-9(12)5-6-10(13)14/h8,11H,2-7H2,1H3,(H,13,14).
What are the key properties of 6-hydroxy-4-oxodecanoic acid?
6-hydroxy-4-oxodecanoic acid has a molecular weight of 202.25 g/mol, XLogP of 1.36, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-4-oxodecanoic acid is sourced from PubChem (CID 14616482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).