About propyl 3-hydroxyhexanoate
propyl 3-hydroxyhexanoate (PubChem CID 14915819) has the molecular formula C9H18O3
and a molecular weight of 174.24 g/mol. Its IUPAC name is propyl 3-hydroxyhexanoate.
Molecular Properties
| Compound Name | propyl 3-hydroxyhexanoate |
| PubChem CID | 14915819 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | propyl 3-hydroxyhexanoate |
| SMILES | CCCOC(=O)CC(O)CCC |
| InChI | InChI=1S/C9H18O3/c1-3-5-8(10)7-9(11)12-6-4-2/h8,10H,3-7H2,1-2H3 |
| InChIKey | CWVLNJIMVHQEAU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propyl 3-hydroxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 3-hydroxyhexanoate?
The IUPAC name of propyl 3-hydroxyhexanoate (CID 14915819) is propyl 3-hydroxyhexanoate.
What is the SMILES notation for propyl 3-hydroxyhexanoate?
The canonical SMILES for propyl 3-hydroxyhexanoate is CCCOC(=O)CC(O)CCC.
What is the InChIKey of propyl 3-hydroxyhexanoate?
The InChIKey is CWVLNJIMVHQEAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O3/c1-3-5-8(10)7-9(11)12-6-4-2/h8,10H,3-7H2,1-2H3.
What are the key properties of propyl 3-hydroxyhexanoate?
propyl 3-hydroxyhexanoate has a molecular weight of 174.24 g/mol, XLogP of 1.49, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 3-hydroxyhexanoate is sourced from PubChem (CID 14915819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).