C23H42N2O9 — CID 91698004
propyl 2-[[3-[bis(2-oxo-2-propoxyethyl)amino]-2-hydroxypropyl]-(2-oxo-2-propoxyethyl)amino]acetate (PubChem CID 91698004) has the molecular formula C23H42N2O9 and a molecular weight of 490.59 g/mol. Its IUPAC name is propyl 2-[[3-[bis(2-oxo-2-propoxyethyl)amino]-2-hydroxypropyl]-(2-oxo-2-propoxyethyl)amino]acetate.
| Compound Name | propyl 2-[[3-[bis(2-oxo-2-propoxyethyl)amino]-2-hydroxypropyl]-(2-oxo-2-propoxyethyl)amino]acetate |
|---|---|
| PubChem CID | 91698004 |
| Molecular Formula | C23H42N2O9 |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | propyl 2-[[3-[bis(2-oxo-2-propoxyethyl)amino]-2-hydroxypropyl]-(2-oxo-2-propoxyethyl)amino]acetate |
| SMILES | CCCOC(=O)CN(CC(=O)OCCC)CC(O)CN(CC(=O)OCCC)CC(=O)OCCC |
| InChI | InChI=1S/C23H42N2O9/c1-5-9-31-20(27)15-24(16-21(28)32-10-6-2)13-19(26)14-25(17-22(29)33-11-7-3)18-23(30)34-12-8-4/h19,26H,5-18H2,1-4H3 |
| InChIKey | CRLWSCHUWWNWBO-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 131.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|