C10H19F2NO3 — CID 107480814
butyl 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]acetate (PubChem CID 107480814) has the molecular formula C10H19F2NO3 and a molecular weight of 239.26 g/mol. Its IUPAC name is butyl 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]acetate.
| Compound Name | butyl 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]acetate |
|---|---|
| PubChem CID | 107480814 |
| Molecular Formula | C10H19F2NO3 |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | butyl 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]acetate |
| SMILES | CCCCOC(=O)CN(CCO)CC(F)F |
| InChI | InChI=1S/C10H19F2NO3/c1-2-3-6-16-10(15)8-13(4-5-14)7-9(11)12/h9,14H,2-8H2,1H3 |
| InChIKey | MILVHZYUHMEPIP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|