C11H23F2NO3 — CID 107483861
1-butoxy-3-[2,2-difluoroethyl(2-hydroxyethyl)amino]propan-2-ol (PubChem CID 107483861) has the molecular formula C11H23F2NO3 and a molecular weight of 255.30 g/mol. Its IUPAC name is 1-butoxy-3-[2,2-difluoroethyl(2-hydroxyethyl)amino]propan-2-ol.
| Compound Name | 1-butoxy-3-[2,2-difluoroethyl(2-hydroxyethyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 107483861 |
| Molecular Formula | C11H23F2NO3 |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 1-butoxy-3-[2,2-difluoroethyl(2-hydroxyethyl)amino]propan-2-ol |
| SMILES | CCCCOCC(O)CN(CCO)CC(F)F |
| InChI | InChI=1S/C11H23F2NO3/c1-2-3-6-17-9-10(16)7-14(4-5-15)8-11(12)13/h10-11,15-16H,2-9H2,1H3 |
| InChIKey | WBAUWHTXAWFJSW-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|