C11H21NO6 — CID 124630639
2-[[(2R)-3-butoxy-2-hydroxypropyl]-(carboxymethyl)amino]acetic acid (PubChem CID 124630639) has the molecular formula C11H21NO6 and a molecular weight of 263.29 g/mol. Its IUPAC name is 2-[[(2R)-3-butoxy-2-hydroxypropyl]-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[[(2R)-3-butoxy-2-hydroxypropyl]-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 124630639 |
| Molecular Formula | C11H21NO6 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 2-[[(2R)-3-butoxy-2-hydroxypropyl]-(carboxymethyl)amino]acetic acid |
| SMILES | CCCCOC[C@H](O)CN(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C11H21NO6/c1-2-3-4-18-8-9(13)5-12(6-10(14)15)7-11(16)17/h9,13H,2-8H2,1H3,(H,14,15)(H,16,17)/t9-/m1/s1 |
| InChIKey | MEFRSPCAEIYGIX-SECBINFHSA-N |
| XLogP | -0.36 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|