C11H20NNaO6 — CID 56842597
sodium 2-[(3-butoxy-2-hydroxypropyl)-(carboxymethyl)amino]acetate (PubChem CID 56842597) has the molecular formula C11H20NNaO6 and a molecular weight of 285.27 g/mol. Its IUPAC name is sodium 2-[(3-butoxy-2-hydroxypropyl)-(carboxymethyl)amino]acetate.
| Compound Name | sodium 2-[(3-butoxy-2-hydroxypropyl)-(carboxymethyl)amino]acetate |
|---|---|
| PubChem CID | 56842597 |
| Molecular Formula | C11H20NNaO6 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | sodium 2-[(3-butoxy-2-hydroxypropyl)-(carboxymethyl)amino]acetate |
| SMILES | CCCCOCC(O)CN(CC(=O)[O-])CC(=O)O.[Na+] |
| InChI | InChI=1S/C11H21NO6.Na/c1-2-3-4-18-8-9(13)5-12(6-10(14)15)7-11(16)17;/h9,13H,2-8H2,1H3,(H,14,15)(H,16,17);/q;+1/p-1 |
| InChIKey | NSPHGFIOPFZHON-UHFFFAOYSA-M |
| XLogP | -4.70 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | -4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|