1-butoxypropan-2-ol;propanoic acid

C10H22O4 — CID 87504807

IUPAC1-butoxypropan-2-ol;propanoic acid
SMILESCCC(=O)O.CCCCOCC(C)O
InChIInChI=1S/C7H16O2.C3H6O2/c1-3-4-5-9-6-7(2)8;1-2-3(4)5/h7-8H,3-6H2,1-2H3;2H2,1H3,(H,4,5)
InChIKeyIZUAQSMCYMBRFT-UHFFFAOYSA-N
MW206.28 g/mol
LogP1.66
Rot. Bonds6

About 1-butoxypropan-2-ol;propanoic acid

1-butoxypropan-2-ol;propanoic acid (PubChem CID 87504807) has the molecular formula C10H22O4 and a molecular weight of 206.28 g/mol. Its IUPAC name is 1-butoxypropan-2-ol;propanoic acid.

Molecular Properties

Compound Name1-butoxypropan-2-ol;propanoic acid
PubChem CID87504807
Molecular FormulaC10H22O4
Molecular Weight206.28 g/mol
Exact Mass206.15
IUPAC Name1-butoxypropan-2-ol;propanoic acid
SMILESCCC(=O)O.CCCCOCC(C)O
InChIInChI=1S/C7H16O2.C3H6O2/c1-3-4-5-9-6-7(2)8;1-2-3(4)5/h7-8H,3-6H2,1-2H3;2H2,1H3,(H,4,5)
InChIKeyIZUAQSMCYMBRFT-UHFFFAOYSA-N
XLogP1.66
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.28
LogP ≤ 51.66
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 1-butoxypropan-2-ol;propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-butoxypropan-2-ol;propanoic acid?
The IUPAC name of 1-butoxypropan-2-ol;propanoic acid (CID 87504807) is 1-butoxypropan-2-ol;propanoic acid.
What is the SMILES notation for 1-butoxypropan-2-ol;propanoic acid?
The canonical SMILES for 1-butoxypropan-2-ol;propanoic acid is CCC(=O)O.CCCCOCC(C)O.
What is the InChIKey of 1-butoxypropan-2-ol;propanoic acid?
The InChIKey is IZUAQSMCYMBRFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O2.C3H6O2/c1-3-4-5-9-6-7(2)8;1-2-3(4)5/h7-8H,3-6H2,1-2H3;2H2,1H3,(H,4,5).
What are the key properties of 1-butoxypropan-2-ol;propanoic acid?
1-butoxypropan-2-ol;propanoic acid has a molecular weight of 206.28 g/mol, XLogP of 1.66, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butoxypropan-2-ol;propanoic acid is sourced from PubChem (CID 87504807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).