About 1-butoxypropan-2-ol;propanoic acid
1-butoxypropan-2-ol;propanoic acid (PubChem CID 87504807) has the molecular formula C10H22O4
and a molecular weight of 206.28 g/mol. Its IUPAC name is 1-butoxypropan-2-ol;propanoic acid.
Molecular Properties
| Compound Name | 1-butoxypropan-2-ol;propanoic acid |
| PubChem CID | 87504807 |
| Molecular Formula | C10H22O4 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 1-butoxypropan-2-ol;propanoic acid |
| SMILES | CCC(=O)O.CCCCOCC(C)O |
| InChI | InChI=1S/C7H16O2.C3H6O2/c1-3-4-5-9-6-7(2)8;1-2-3(4)5/h7-8H,3-6H2,1-2H3;2H2,1H3,(H,4,5) |
| InChIKey | IZUAQSMCYMBRFT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butoxypropan-2-ol;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butoxypropan-2-ol;propanoic acid?
The IUPAC name of 1-butoxypropan-2-ol;propanoic acid (CID 87504807) is 1-butoxypropan-2-ol;propanoic acid.
What is the SMILES notation for 1-butoxypropan-2-ol;propanoic acid?
The canonical SMILES for 1-butoxypropan-2-ol;propanoic acid is CCC(=O)O.CCCCOCC(C)O.
What is the InChIKey of 1-butoxypropan-2-ol;propanoic acid?
The InChIKey is IZUAQSMCYMBRFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O2.C3H6O2/c1-3-4-5-9-6-7(2)8;1-2-3(4)5/h7-8H,3-6H2,1-2H3;2H2,1H3,(H,4,5).
What are the key properties of 1-butoxypropan-2-ol;propanoic acid?
1-butoxypropan-2-ol;propanoic acid has a molecular weight of 206.28 g/mol, XLogP of 1.66, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butoxypropan-2-ol;propanoic acid is sourced from PubChem (CID 87504807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).