C17H36O10 — CID 161461664
butanedioic acid;1-(2-hydroxyethoxy)hexan-2-ol;1-(2-hydroxyethoxy)propan-2-ol (PubChem CID 161461664) has the molecular formula C17H36O10 and a molecular weight of 400.47 g/mol. Its IUPAC name is butanedioic acid;1-(2-hydroxyethoxy)hexan-2-ol;1-(2-hydroxyethoxy)propan-2-ol.
| Compound Name | butanedioic acid;1-(2-hydroxyethoxy)hexan-2-ol;1-(2-hydroxyethoxy)propan-2-ol |
|---|---|
| PubChem CID | 161461664 |
| Molecular Formula | C17H36O10 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | butanedioic acid;1-(2-hydroxyethoxy)hexan-2-ol;1-(2-hydroxyethoxy)propan-2-ol |
| SMILES | CC(O)COCCO.CCCCC(O)COCCO.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C8H18O3.C5H12O3.C4H6O4/c1-2-3-4-8(10)7-11-6-5-9;1-5(7)4-8-3-2-6;5-3(6)1-2-4(7)8/h8-10H,2-7H2,1H3;5-7H,2-4H2,1H3;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | WBWYLSXQVJRQJD-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|