C21H42O8S — CID 87720092
butanedioic acid;1-[2-(2-hydroxyethoxy)ethoxy]-13-sulfanyltridecan-2-ol (PubChem CID 87720092) has the molecular formula C21H42O8S and a molecular weight of 454.63 g/mol. Its IUPAC name is butanedioic acid;1-[2-(2-hydroxyethoxy)ethoxy]-13-sulfanyltridecan-2-ol.
| Compound Name | butanedioic acid;1-[2-(2-hydroxyethoxy)ethoxy]-13-sulfanyltridecan-2-ol |
|---|---|
| PubChem CID | 87720092 |
| Molecular Formula | C21H42O8S |
| Molecular Weight | 454.63 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | butanedioic acid;1-[2-(2-hydroxyethoxy)ethoxy]-13-sulfanyltridecan-2-ol |
| SMILES | O=C(O)CCC(=O)O.OCCOCCOCC(O)CCCCCCCCCCCS |
| InChI | InChI=1S/C17H36O4S.C4H6O4/c18-11-12-20-13-14-21-16-17(19)10-8-6-4-2-1-3-5-7-9-15-22;5-3(6)1-2-4(7)8/h17-19,22H,1-16H2;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | BJCJBCWKGQDIAE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.63 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|