C10H22O5 — CID 87319718
acetic acid;1-(2-hydroxyethoxy)hexan-2-ol (PubChem CID 87319718) has the molecular formula C10H22O5 and a molecular weight of 222.28 g/mol. Its IUPAC name is acetic acid;1-(2-hydroxyethoxy)hexan-2-ol.
| Compound Name | acetic acid;1-(2-hydroxyethoxy)hexan-2-ol |
|---|---|
| PubChem CID | 87319718 |
| Molecular Formula | C10H22O5 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | acetic acid;1-(2-hydroxyethoxy)hexan-2-ol |
| SMILES | CC(=O)O.CCCCC(O)COCCO |
| InChI | InChI=1S/C8H18O3.C2H4O2/c1-2-3-4-8(10)7-11-6-5-9;1-2(3)4/h8-10H,2-7H2,1H3;1H3,(H,3,4) |
| InChIKey | MOLJQGQRQUNWRW-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|